C18H11ClF3N5 — CID 112906041
3-[[2-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzonitrile (PubChem CID 112906041) has the molecular formula C18H11ClF3N5 and a molecular weight of 389.77 g/mol. Its IUPAC name is 3-[[2-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[2-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112906041 |
| Molecular Formula | C18H11ClF3N5 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 3-[[2-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1cccc(Nc2ccnc(Nc3cc(C(F)(F)F)ccc3Cl)n2)c1 |
| InChI | InChI=1S/C18H11ClF3N5/c19-14-5-4-12(18(20,21)22)9-15(14)26-17-24-7-6-16(27-17)25-13-3-1-2-11(8-13)10-23/h1-9H,(H2,24,25,26,27) |
| InChIKey | SICLEZGQTXIYPM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |