C17H11Cl2N5 — CID 112906674
4-[[4-(2,5-dichloroanilino)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 112906674) has the molecular formula C17H11Cl2N5 and a molecular weight of 356.22 g/mol. Its IUPAC name is 4-[[4-(2,5-dichloroanilino)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-(2,5-dichloroanilino)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112906674 |
| Molecular Formula | C17H11Cl2N5 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-[[4-(2,5-dichloroanilino)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc(Nc3cc(Cl)ccc3Cl)n2)cc1 |
| InChI | InChI=1S/C17H11Cl2N5/c18-12-3-6-14(19)15(9-12)23-16-7-8-21-17(24-16)22-13-4-1-11(10-20)2-5-13/h1-9H,(H2,21,22,23,24) |
| InChIKey | PLQPJGUHVFPYQW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |