C24H15FN6 — CID 155552933
4-[4-[[2-(4-cyanoanilino)pyrimidin-4-yl]amino]-2-fluorophenyl]benzonitrile (PubChem CID 155552933) has the molecular formula C24H15FN6 and a molecular weight of 406.42 g/mol. Its IUPAC name is 4-[4-[[2-(4-cyanoanilino)pyrimidin-4-yl]amino]-2-fluorophenyl]benzonitrile.
| Compound Name | 4-[4-[[2-(4-cyanoanilino)pyrimidin-4-yl]amino]-2-fluorophenyl]benzonitrile |
|---|---|
| PubChem CID | 155552933 |
| Molecular Formula | C24H15FN6 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 4-[4-[[2-(4-cyanoanilino)pyrimidin-4-yl]amino]-2-fluorophenyl]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc(Nc3ccc(-c4ccc(C#N)cc4)c(F)c3)n2)cc1 |
| InChI | InChI=1S/C24H15FN6/c25-22-13-20(9-10-21(22)18-5-1-16(14-26)2-6-18)29-23-11-12-28-24(31-23)30-19-7-3-17(15-27)4-8-19/h1-13H,(H2,28,29,30,31) |
| InChIKey | YMDCHOSJZRLZDN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |