C23H17N5O — CID 112906255
4-[[4-(4-phenoxyanilino)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 112906255) has the molecular formula C23H17N5O and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-[[4-(4-phenoxyanilino)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-(4-phenoxyanilino)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112906255 |
| Molecular Formula | C23H17N5O |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[[4-(4-phenoxyanilino)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc(Nc3ccc(Oc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C23H17N5O/c24-16-17-6-8-19(9-7-17)27-23-25-15-14-22(28-23)26-18-10-12-21(13-11-18)29-20-4-2-1-3-5-20/h1-15H,(H2,25,26,27,28) |
| InChIKey | YFFUATDZICMKOS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |