C21H22N6 — CID 112906110
4-[[4-[4-(diethylamino)anilino]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 112906110) has the molecular formula C21H22N6 and a molecular weight of 358.45 g/mol. Its IUPAC name is 4-[[4-[4-(diethylamino)anilino]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-(diethylamino)anilino]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112906110 |
| Molecular Formula | C21H22N6 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 4-[[4-[4-(diethylamino)anilino]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | CCN(CC)c1ccc(Nc2ccnc(Nc3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C21H22N6/c1-3-27(4-2)19-11-9-17(10-12-19)24-20-13-14-23-21(26-20)25-18-7-5-16(15-22)6-8-18/h5-14H,3-4H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | AHKPBLOBWHHKAI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|