C21H23N5O2 — CID 113193758
3-[[2-[4-(diethylamino)anilino]pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113193758) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 3-[[2-[4-(diethylamino)anilino]pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[2-[4-(diethylamino)anilino]pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113193758 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 3-[[2-[4-(diethylamino)anilino]pyrimidin-4-yl]amino]benzoic acid |
| SMILES | CCN(CC)c1ccc(Nc2nccc(Nc3cccc(C(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C21H23N5O2/c1-3-26(4-2)18-10-8-16(9-11-18)24-21-22-13-12-19(25-21)23-17-7-5-6-15(14-17)20(27)28/h5-14H,3-4H2,1-2H3,(H,27,28)(H2,22,23,24,25) |
| InChIKey | RLTOHQIEHAMVIG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|