C18H14N4O4 — CID 91900818
2-[[4-(3-carboxyanilino)pyrimidin-2-yl]amino]benzoic acid (PubChem CID 91900818) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is 2-[[4-(3-carboxyanilino)pyrimidin-2-yl]amino]benzoic acid.
| Compound Name | 2-[[4-(3-carboxyanilino)pyrimidin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 91900818 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-[[4-(3-carboxyanilino)pyrimidin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2ccnc(Nc3ccccc3C(=O)O)n2)c1 |
| InChI | InChI=1S/C18H14N4O4/c23-16(24)11-4-3-5-12(10-11)20-15-8-9-19-18(22-15)21-14-7-2-1-6-13(14)17(25)26/h1-10H,(H,23,24)(H,25,26)(H2,19,20,21,22) |
| InChIKey | MMELOQRIEQIYEP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |