C16H20N4O2 — CID 113193723
3-[[2-(3-methylbutylamino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113193723) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[[2-(3-methylbutylamino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[2-(3-methylbutylamino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113193723 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-[[2-(3-methylbutylamino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | CC(C)CCNc1nccc(Nc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C16H20N4O2/c1-11(2)6-8-17-16-18-9-7-14(20-16)19-13-5-3-4-12(10-13)15(21)22/h3-5,7,9-11H,6,8H2,1-2H3,(H,21,22)(H2,17,18,19,20) |
| InChIKey | JZGULISOUAMWJM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |