C21H24ClN5 — CID 112904070
4-N-(3-chloro-4-methylphenyl)-2-N-[4-(diethylamino)phenyl]pyrimidine-2,4-diamine (PubChem CID 112904070) has the molecular formula C21H24ClN5 and a molecular weight of 381.91 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methylphenyl)-2-N-[4-(diethylamino)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-chloro-4-methylphenyl)-2-N-[4-(diethylamino)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112904070 |
| Molecular Formula | C21H24ClN5 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-N-(3-chloro-4-methylphenyl)-2-N-[4-(diethylamino)phenyl]pyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nccc(Nc3ccc(C)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C21H24ClN5/c1-4-27(5-2)18-10-8-16(9-11-18)25-21-23-13-12-20(26-21)24-17-7-6-15(3)19(22)14-17/h6-14H,4-5H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | MURCSTBDTLFUFW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|