C21H24FN5 — CID 112891323
4-N-[4-(diethylamino)phenyl]-2-N-[(2-fluorophenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 112891323) has the molecular formula C21H24FN5 and a molecular weight of 365.46 g/mol. Its IUPAC name is 4-N-[4-(diethylamino)phenyl]-2-N-[(2-fluorophenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-(diethylamino)phenyl]-2-N-[(2-fluorophenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112891323 |
| Molecular Formula | C21H24FN5 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-N-[4-(diethylamino)phenyl]-2-N-[(2-fluorophenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2ccnc(NCc3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C21H24FN5/c1-3-27(4-2)18-11-9-17(10-12-18)25-20-13-14-23-21(26-20)24-15-16-7-5-6-8-19(16)22/h5-14H,3-4,15H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | IFGQYZQVNWKTPE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|