C22H17FN4O — CID 112903553
2-N-(4-fluorophenyl)-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112903553) has the molecular formula C22H17FN4O and a molecular weight of 372.40 g/mol. Its IUPAC name is 2-N-(4-fluorophenyl)-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-fluorophenyl)-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112903553 |
| Molecular Formula | C22H17FN4O |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-N-(4-fluorophenyl)-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | Fc1ccc(Nc2nccc(Nc3ccc(Oc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C22H17FN4O/c23-16-6-8-18(9-7-16)26-22-24-15-14-21(27-22)25-17-10-12-20(13-11-17)28-19-4-2-1-3-5-19/h1-15H,(H2,24,25,26,27) |
| InChIKey | XQGQNGUEQZIEDU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |