C17H15N3O2 — CID 175988564
[4-(4-phenoxyanilino)pyrimidin-2-yl]methanol (PubChem CID 175988564) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is [4-(4-phenoxyanilino)pyrimidin-2-yl]methanol.
| Compound Name | [4-(4-phenoxyanilino)pyrimidin-2-yl]methanol |
|---|---|
| PubChem CID | 175988564 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | [4-(4-phenoxyanilino)pyrimidin-2-yl]methanol |
| SMILES | OCc1nccc(Nc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C17H15N3O2/c21-12-17-18-11-10-16(20-17)19-13-6-8-15(9-7-13)22-14-4-2-1-3-5-14/h1-11,21H,12H2,(H,18,19,20) |
| InChIKey | KFEIYFGUGUDOSF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |