C20H19N3O — CID 170619915
2-(2-methylprop-2-enyl)-N-(4-phenoxyphenyl)pyrimidin-4-amine (PubChem CID 170619915) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-N-(4-phenoxyphenyl)pyrimidin-4-amine.
| Compound Name | 2-(2-methylprop-2-enyl)-N-(4-phenoxyphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 170619915 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-N-(4-phenoxyphenyl)pyrimidin-4-amine |
| SMILES | C=C(C)Cc1nccc(Nc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C20H19N3O/c1-15(2)14-20-21-13-12-19(23-20)22-16-8-10-18(11-9-16)24-17-6-4-3-5-7-17/h3-13H,1,14H2,2H3,(H,21,22,23) |
| InChIKey | MLQJNRGNIFFWDW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|