C23H20N4O — CID 112902142
2-N-methyl-4-N-(4-phenoxyphenyl)-2-N-phenylpyrimidine-2,4-diamine (PubChem CID 112902142) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-N-methyl-4-N-(4-phenoxyphenyl)-2-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-methyl-4-N-(4-phenoxyphenyl)-2-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112902142 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-N-methyl-4-N-(4-phenoxyphenyl)-2-N-phenylpyrimidine-2,4-diamine |
| SMILES | CN(c1ccccc1)c1nccc(Nc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C23H20N4O/c1-27(19-8-4-2-5-9-19)23-24-17-16-22(26-23)25-18-12-14-21(15-13-18)28-20-10-6-3-7-11-20/h2-17H,1H3,(H,24,25,26) |
| InChIKey | GXWKRISOYGOBJS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |