C19H20N4O — CID 112902126
4-N-(4-ethoxyphenyl)-2-N-methyl-2-N-phenylpyrimidine-2,4-diamine (PubChem CID 112902126) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 4-N-(4-ethoxyphenyl)-2-N-methyl-2-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-ethoxyphenyl)-2-N-methyl-2-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112902126 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 4-N-(4-ethoxyphenyl)-2-N-methyl-2-N-phenylpyrimidine-2,4-diamine |
| SMILES | CCOc1ccc(Nc2ccnc(N(C)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H20N4O/c1-3-24-17-11-9-15(10-12-17)21-18-13-14-20-19(22-18)23(2)16-7-5-4-6-8-16/h4-14H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | FLNPYFQMCLUTMP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |