C18H17FN4O — CID 112903465
4-N-(4-ethoxyphenyl)-2-N-(2-fluorophenyl)pyrimidine-2,4-diamine (PubChem CID 112903465) has the molecular formula C18H17FN4O and a molecular weight of 324.36 g/mol. Its IUPAC name is 4-N-(4-ethoxyphenyl)-2-N-(2-fluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-ethoxyphenyl)-2-N-(2-fluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112903465 |
| Molecular Formula | C18H17FN4O |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-N-(4-ethoxyphenyl)-2-N-(2-fluorophenyl)pyrimidine-2,4-diamine |
| SMILES | CCOc1ccc(Nc2ccnc(Nc3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C18H17FN4O/c1-2-24-14-9-7-13(8-10-14)21-17-11-12-20-18(23-17)22-16-6-4-3-5-15(16)19/h3-12H,2H2,1H3,(H2,20,21,22,23) |
| InChIKey | LEDXFBJSQVVDNE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |