C19H17FN4O2 — CID 112903532
ethyl 2-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]benzoate (PubChem CID 112903532) has the molecular formula C19H17FN4O2 and a molecular weight of 352.37 g/mol. Its IUPAC name is ethyl 2-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]benzoate.
| Compound Name | ethyl 2-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112903532 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | ethyl 2-[[4-(4-fluoroanilino)pyrimidin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1nccc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H17FN4O2/c1-2-26-18(25)15-5-3-4-6-16(15)23-19-21-12-11-17(24-19)22-14-9-7-13(20)8-10-14/h3-12H,2H2,1H3,(H2,21,22,23,24) |
| InChIKey | HQYAFGPYPHBPFT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |