C19H16F2N4O2 — CID 112906518
ethyl 4-[[2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]benzoate (PubChem CID 112906518) has the molecular formula C19H16F2N4O2 and a molecular weight of 370.36 g/mol. Its IUPAC name is ethyl 4-[[2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112906518 |
| Molecular Formula | C19H16F2N4O2 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | ethyl 4-[[2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ccnc(Nc3ccc(F)cc3F)n2)cc1 |
| InChI | InChI=1S/C19H16F2N4O2/c1-2-27-18(26)12-3-6-14(7-4-12)23-17-9-10-22-19(25-17)24-16-8-5-13(20)11-15(16)21/h3-11H,2H2,1H3,(H2,22,23,24,25) |
| InChIKey | KTPRRXRNHNQJLP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |