C20H17N5O2 — CID 112906530
ethyl 4-[[4-(3-cyanoanilino)pyrimidin-2-yl]amino]benzoate (PubChem CID 112906530) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is ethyl 4-[[4-(3-cyanoanilino)pyrimidin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(3-cyanoanilino)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112906530 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | ethyl 4-[[4-(3-cyanoanilino)pyrimidin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nccc(Nc3cccc(C#N)c3)n2)cc1 |
| InChI | InChI=1S/C20H17N5O2/c1-2-27-19(26)15-6-8-16(9-7-15)24-20-22-11-10-18(25-20)23-17-5-3-4-14(12-17)13-21/h3-12H,2H2,1H3,(H2,22,23,24,25) |
| InChIKey | YEYQCILRUYXGHF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |