C22H19N5O2 — CID 112906513
ethyl 2-[[2-(quinolin-8-ylamino)pyrimidin-4-yl]amino]benzoate (PubChem CID 112906513) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is ethyl 2-[[2-(quinolin-8-ylamino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(quinolin-8-ylamino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112906513 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | ethyl 2-[[2-(quinolin-8-ylamino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ccnc(Nc2cccc3cccnc23)n1 |
| InChI | InChI=1S/C22H19N5O2/c1-2-29-21(28)16-9-3-4-10-17(16)25-19-12-14-24-22(27-19)26-18-11-5-7-15-8-6-13-23-20(15)18/h3-14H,2H2,1H3,(H2,24,25,26,27) |
| InChIKey | AMJJBJIUMNRXIE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |