C21H18N6O2 — CID 112969349
ethyl 2-[[5-(quinolin-8-ylamino)-1,2,4-triazin-3-yl]amino]benzoate (PubChem CID 112969349) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is ethyl 2-[[5-(quinolin-8-ylamino)-1,2,4-triazin-3-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-(quinolin-8-ylamino)-1,2,4-triazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 112969349 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | ethyl 2-[[5-(quinolin-8-ylamino)-1,2,4-triazin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1nncc(Nc2cccc3cccnc23)n1 |
| InChI | InChI=1S/C21H18N6O2/c1-2-29-20(28)15-9-3-4-10-16(15)25-21-26-18(13-23-27-21)24-17-11-5-7-14-8-6-12-22-19(14)17/h3-13H,2H2,1H3,(H2,24,25,26,27) |
| InChIKey | VIYGVZNOAIFTEB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |