C21H23N5O2 — CID 112964819
ethyl 2-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]benzoate (PubChem CID 112964819) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is ethyl 2-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 112964819 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | ethyl 2-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1nncc(Nc2ccc(C(C)C)cc2)n1 |
| InChI | InChI=1S/C21H23N5O2/c1-4-28-20(27)17-7-5-6-8-18(17)24-21-25-19(13-22-26-21)23-16-11-9-15(10-12-16)14(2)3/h5-14H,4H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | REPZJZJTVMNKNW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |