C16H18N4O2 — CID 112882454
ethyl 2-[[2-(cyclopropylamino)pyrimidin-4-yl]amino]benzoate (PubChem CID 112882454) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is ethyl 2-[[2-(cyclopropylamino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(cyclopropylamino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112882454 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | ethyl 2-[[2-(cyclopropylamino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ccnc(NC2CC2)n1 |
| InChI | InChI=1S/C16H18N4O2/c1-2-22-15(21)12-5-3-4-6-13(12)19-14-9-10-17-16(20-14)18-11-7-8-11/h3-6,9-11H,2,7-8H2,1H3,(H2,17,18,19,20) |
| InChIKey | BQKUESDCWMVUGI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |