C16H18N4O4S — CID 112896017
methyl 2-[[2-[(1,1-dioxothiolan-3-yl)amino]pyrimidin-4-yl]amino]benzoate (PubChem CID 112896017) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is methyl 2-[[2-[(1,1-dioxothiolan-3-yl)amino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[2-[(1,1-dioxothiolan-3-yl)amino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112896017 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | methyl 2-[[2-[(1,1-dioxothiolan-3-yl)amino]pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ccnc(NC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C16H18N4O4S/c1-24-15(21)12-4-2-3-5-13(12)19-14-6-8-17-16(20-14)18-11-7-9-25(22,23)10-11/h2-6,8,11H,7,9-10H2,1H3,(H2,17,18,19,20) |
| InChIKey | ULHHHCWNRZKTIY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |