C13H16N2O5S — CID 71691549
methyl 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzoate (PubChem CID 71691549) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is methyl 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzoate.
| Compound Name | methyl 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 71691549 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | methyl 2-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16N2O5S/c1-20-12(16)10-4-2-3-5-11(10)15-13(17)14-9-6-7-21(18,19)8-9/h2-5,9H,6-8H2,1H3,(H2,14,15,17) |
| InChIKey | PMEUYBBLUKWLBA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |