C12H15ClN2O4S — CID 95239873
1-(2-chloro-4-methoxyphenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea (PubChem CID 95239873) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is 1-(2-chloro-4-methoxyphenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-(2-chloro-4-methoxyphenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 95239873 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 1-(2-chloro-4-methoxyphenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
| SMILES | COc1ccc(NC(=O)N[C@@H]2CCS(=O)(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClN2O4S/c1-19-9-2-3-11(10(13)6-9)15-12(16)14-8-4-5-20(17,18)7-8/h2-3,6,8H,4-5,7H2,1H3,(H2,14,15,16)/t8-/m1/s1 |
| InChIKey | ZJDSCVUZPNKYPO-MRVPVSSYSA-N |
| XLogP | 1.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |