C12H15BrN2O4S — CID 60545846
1-(5-bromo-2-methoxyphenyl)-3-(1,1-dioxothiolan-3-yl)urea (PubChem CID 60545846) has the molecular formula C12H15BrN2O4S and a molecular weight of 363.23 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-3-(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-3-(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 60545846 |
| Molecular Formula | C12H15BrN2O4S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-3-(1,1-dioxothiolan-3-yl)urea |
| SMILES | COc1ccc(Br)cc1NC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15BrN2O4S/c1-19-11-3-2-8(13)6-10(11)15-12(16)14-9-4-5-20(17,18)7-9/h2-3,6,9H,4-5,7H2,1H3,(H2,14,15,16) |
| InChIKey | WPHSKCJDBLCQHV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |