C11H13BrN2O3S — CID 47191942
1-(4-bromophenyl)-3-(1,1-dioxothiolan-3-yl)urea (PubChem CID 47191942) has the molecular formula C11H13BrN2O3S and a molecular weight of 333.21 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-(4-bromophenyl)-3-(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 47191942 |
| Molecular Formula | C11H13BrN2O3S |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 1-(4-bromophenyl)-3-(1,1-dioxothiolan-3-yl)urea |
| SMILES | O=C(Nc1ccc(Br)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13BrN2O3S/c12-8-1-3-9(4-2-8)13-11(15)14-10-5-6-18(16,17)7-10/h1-4,10H,5-7H2,(H2,13,14,15) |
| InChIKey | SRIAJQIUPVGOFH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |