C13H16N2O5S — CID 63923964
4-[(1,1-dioxothian-3-yl)carbamoylamino]benzoic acid (PubChem CID 63923964) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-3-yl)carbamoylamino]benzoic acid.
| Compound Name | 4-[(1,1-dioxothian-3-yl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 63923964 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-[(1,1-dioxothian-3-yl)carbamoylamino]benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)cc1)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16N2O5S/c16-12(17)9-3-5-10(6-4-9)14-13(18)15-11-2-1-7-21(19,20)8-11/h3-6,11H,1-2,7-8H2,(H,16,17)(H2,14,15,18) |
| InChIKey | VEMRVKQOZBNRTO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |