C12H15N3O4S — CID 102566557
N-[4-[(1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]formamide (PubChem CID 102566557) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-[4-[(1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]formamide.
| Compound Name | N-[4-[(1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]formamide |
|---|---|
| PubChem CID | 102566557 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[4-[(1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]formamide |
| SMILES | O=CNc1ccc(NC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C12H15N3O4S/c16-8-13-9-1-3-10(4-2-9)14-12(17)15-11-5-6-20(18,19)7-11/h1-4,8,11H,5-7H2,(H,13,16)(H2,14,15,17) |
| InChIKey | MDTMBEKCKCELSP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|