C11H14N2O4S — CID 102566980
1-(1,1-dioxothiolan-3-yl)-3-(2-hydroxyphenyl)urea (PubChem CID 102566980) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(2-hydroxyphenyl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(2-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 102566980 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(2-hydroxyphenyl)urea |
| SMILES | O=C(Nc1ccccc1O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H14N2O4S/c14-10-4-2-1-3-9(10)13-11(15)12-8-5-6-18(16,17)7-8/h1-4,8,14H,5-7H2,(H2,12,13,15) |
| InChIKey | NQAHBQLQIPCNLD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|