C11H13ClN2O3S — CID 7256191
1-(2-chlorophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea (PubChem CID 7256191) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 7256191 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
| SMILES | O=C(Nc1ccccc1Cl)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13ClN2O3S/c12-9-3-1-2-4-10(9)14-11(15)13-8-5-6-18(16,17)7-8/h1-4,8H,5-7H2,(H2,13,14,15)/t8-/m1/s1 |
| InChIKey | SAKZBVDVBZMESQ-MRVPVSSYSA-N |
| XLogP | 1.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |