C15H15ClN4O3S — CID 109260888
N-(2-chlorophenyl)-2-[(1,1-dioxothiolan-3-yl)amino]pyrimidine-5-carboxamide (PubChem CID 109260888) has the molecular formula C15H15ClN4O3S and a molecular weight of 366.83 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[(1,1-dioxothiolan-3-yl)amino]pyrimidine-5-carboxamide.
| Compound Name | N-(2-chlorophenyl)-2-[(1,1-dioxothiolan-3-yl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109260888 |
| Molecular Formula | C15H15ClN4O3S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-(2-chlorophenyl)-2-[(1,1-dioxothiolan-3-yl)amino]pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1cnc(NC2CCS(=O)(=O)C2)nc1 |
| InChI | InChI=1S/C15H15ClN4O3S/c16-12-3-1-2-4-13(12)20-14(21)10-7-17-15(18-8-10)19-11-5-6-24(22,23)9-11/h1-4,7-8,11H,5-6,9H2,(H,20,21)(H,17,18,19) |
| InChIKey | YIGHBCZEZWIPQV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |