C16H22N4O4S4 — CID 102566913
1-(1,1-dioxothiolan-3-yl)-3-[2-[(1,1-dioxothiolan-3-yl)carbamothioylamino]phenyl]thiourea (PubChem CID 102566913) has the molecular formula C16H22N4O4S4 and a molecular weight of 462.64 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[2-[(1,1-dioxothiolan-3-yl)carbamothioylamino]phenyl]thiourea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[2-[(1,1-dioxothiolan-3-yl)carbamothioylamino]phenyl]thiourea |
|---|---|
| PubChem CID | 102566913 |
| Molecular Formula | C16H22N4O4S4 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[2-[(1,1-dioxothiolan-3-yl)carbamothioylamino]phenyl]thiourea |
| SMILES | O=S1(=O)CCC(NC(=S)Nc2ccccc2NC(=S)NC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C16H22N4O4S4/c21-27(22)7-5-11(9-27)17-15(25)19-13-3-1-2-4-14(13)20-16(26)18-12-6-8-28(23,24)10-12/h1-4,11-12H,5-10H2,(H2,17,19,25)(H2,18,20,26) |
| InChIKey | BVWCCACWLGOKAP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|