C12H16N2O2S2 — CID 3752369
1-(1,1-dioxothiolan-3-yl)-3-(3-methylphenyl)thiourea (PubChem CID 3752369) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(3-methylphenyl)thiourea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 3752369 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H16N2O2S2/c1-9-3-2-4-10(7-9)13-12(17)14-11-5-6-18(15,16)8-11/h2-4,7,11H,5-6,8H2,1H3,(H2,13,14,17) |
| InChIKey | GCBCKOXDTPHKPP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|