C12H16N2O3S2 — CID 40785237
1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-methoxyphenyl)thiourea (PubChem CID 40785237) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 40785237 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C12H16N2O3S2/c1-17-11-4-2-9(3-5-11)13-12(18)14-10-6-7-19(15,16)8-10/h2-5,10H,6-8H2,1H3,(H2,13,14,18)/t10-/m0/s1 |
| InChIKey | BLGISOHAFZNJEE-JTQLQIEISA-N |
| XLogP | 1.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|