C17H18N2O3S2 — CID 4968946
1-(1,1-dioxothiolan-3-yl)-3-(4-phenoxyphenyl)thiourea (PubChem CID 4968946) has the molecular formula C17H18N2O3S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(4-phenoxyphenyl)thiourea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 4968946 |
| Molecular Formula | C17H18N2O3S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(4-phenoxyphenyl)thiourea |
| SMILES | O=S1(=O)CCC(NC(=S)Nc2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C17H18N2O3S2/c20-24(21)11-10-14(12-24)19-17(23)18-13-6-8-16(9-7-13)22-15-4-2-1-3-5-15/h1-9,14H,10-12H2,(H2,18,19,23) |
| InChIKey | UQVUQZJTJAVNCR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|