C14H13F7N2O2S3 — CID 2313410
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]thiourea (PubChem CID 2313410) has the molecular formula C14H13F7N2O2S3 and a molecular weight of 470.46 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]thiourea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2313410 |
| Molecular Formula | C14H13F7N2O2S3 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]thiourea |
| SMILES | O=S1(=O)CC[C@@H](NC(=S)Nc2ccc(SC(F)(F)C(F)(F)C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H13F7N2O2S3/c15-12(16,13(17,18)19)14(20,21)27-10-3-1-8(2-4-10)22-11(26)23-9-5-6-28(24,25)7-9/h1-4,9H,5-7H2,(H2,22,23,26)/t9-/m1/s1 |
| InChIKey | BKHZCPYOJRVEKI-SECBINFHSA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|