C16H22N2O4S — CID 108526829
N'-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)oxamide (PubChem CID 108526829) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N'-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)oxamide.
| Compound Name | N'-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)oxamide |
|---|---|
| PubChem CID | 108526829 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N'-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)oxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)C(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H22N2O4S/c1-16(2,3)11-4-6-12(7-5-11)17-14(19)15(20)18-13-8-9-23(21,22)10-13/h4-7,13H,8-10H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | OUVSLDCXLUOVNV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|