C14H16N2O6S — CID 108985698
N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(1,1-dioxothiolan-3-yl)oxamide (PubChem CID 108985698) has the molecular formula C14H16N2O6S and a molecular weight of 340.36 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(1,1-dioxothiolan-3-yl)oxamide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(1,1-dioxothiolan-3-yl)oxamide |
|---|---|
| PubChem CID | 108985698 |
| Molecular Formula | C14H16N2O6S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(1,1-dioxothiolan-3-yl)oxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16N2O6S/c17-13(14(18)16-10-3-6-23(19,20)8-10)15-9-1-2-11-12(7-9)22-5-4-21-11/h1-2,7,10H,3-6,8H2,(H,15,17)(H,16,18) |
| InChIKey | OFGLHFHKFUACCW-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|