C17H20N2O6S — CID 108978008
1-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide (PubChem CID 108978008) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is 1-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108978008 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)C1(C(=O)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C17H20N2O6S/c20-15(18-11-1-2-13-14(9-11)25-7-6-24-13)17(4-5-17)16(21)19-12-3-8-26(22,23)10-12/h1-2,9,12H,3-8,10H2,(H,18,20)(H,19,21) |
| InChIKey | KJSHFMULORPSGH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|