C19H19N3O6S — CID 39347045
N-(1,3-benzodioxol-5-yl)-4-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]benzamide (PubChem CID 39347045) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 39347045 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)Nc2ccc3c(c2)OCO3)cc1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19N3O6S/c23-18(20-14-5-6-16-17(9-14)28-11-27-16)12-1-3-13(4-2-12)21-19(24)22-15-7-8-29(25,26)10-15/h1-6,9,15H,7-8,10-11H2,(H,20,23)(H2,21,22,24)/t15-/m1/s1 |
| InChIKey | YPGUXYNIMWUAHJ-OAHLLOKOSA-N |
| XLogP | 1.98 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |