C22H22N2O7S — CID 4832522
N-(1,3-benzodioxol-5-yl)-2-benzoyl-N'-(1,1-dioxothiolan-3-yl)butanediamide (PubChem CID 4832522) has the molecular formula C22H22N2O7S and a molecular weight of 458.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-benzoyl-N'-(1,1-dioxothiolan-3-yl)butanediamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-benzoyl-N'-(1,1-dioxothiolan-3-yl)butanediamide |
|---|---|
| PubChem CID | 4832522 |
| Molecular Formula | C22H22N2O7S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-benzoyl-N'-(1,1-dioxothiolan-3-yl)butanediamide |
| SMILES | O=C(CC(C(=O)Nc1ccc2c(c1)OCO2)C(=O)c1ccccc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H22N2O7S/c25-20(23-16-8-9-32(28,29)12-16)11-17(21(26)14-4-2-1-3-5-14)22(27)24-15-6-7-18-19(10-15)31-13-30-18/h1-7,10,16-17H,8-9,11-13H2,(H,23,25)(H,24,27) |
| InChIKey | ZJJVCUAYPCXBBY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|