C24H26N2O7S — CID 41173371
(2S)-2-benzoyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanediamide (PubChem CID 41173371) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is (2S)-2-benzoyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanediamide.
| Compound Name | (2S)-2-benzoyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanediamide |
|---|---|
| PubChem CID | 41173371 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | (2S)-2-benzoyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanediamide |
| SMILES | C[C@]1(NC(=O)C[C@H](C(=O)Nc2ccc3c(c2)OCCO3)C(=O)c2ccccc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C24H26N2O7S/c1-24(9-12-34(30,31)15-24)26-21(27)14-18(22(28)16-5-3-2-4-6-16)23(29)25-17-7-8-19-20(13-17)33-11-10-32-19/h2-8,13,18H,9-12,14-15H2,1H3,(H,25,29)(H,26,27)/t18-,24-/m0/s1 |
| InChIKey | XQGMKZIZSLRUPJ-UUOWRZLLSA-N |
| XLogP | 1.98 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|