C27H25ClN2O5 — CID 4878524
2-benzoyl-N'-[2-(4-chlorophenyl)ethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)butanediamide (PubChem CID 4878524) has the molecular formula C27H25ClN2O5 and a molecular weight of 492.96 g/mol. Its IUPAC name is 2-benzoyl-N'-[2-(4-chlorophenyl)ethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)butanediamide.
| Compound Name | 2-benzoyl-N'-[2-(4-chlorophenyl)ethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)butanediamide |
|---|---|
| PubChem CID | 4878524 |
| Molecular Formula | C27H25ClN2O5 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-benzoyl-N'-[2-(4-chlorophenyl)ethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)butanediamide |
| SMILES | O=C(CC(C(=O)Nc1ccc2c(c1)OCCO2)C(=O)c1ccccc1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H25ClN2O5/c28-20-8-6-18(7-9-20)12-13-29-25(31)17-22(26(32)19-4-2-1-3-5-19)27(33)30-21-10-11-23-24(16-21)35-15-14-34-23/h1-11,16,22H,12-15,17H2,(H,29,31)(H,30,33) |
| InChIKey | JYLNKBTVYAAUMO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|