C11H13NO4S — CID 43179271
N-(1,1-dioxothiolan-3-yl)-1,3-benzodioxol-5-amine (PubChem CID 43179271) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1,3-benzodioxol-5-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43179271 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1,3-benzodioxol-5-amine |
| SMILES | O=S1(=O)CCC(Nc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C11H13NO4S/c13-17(14)4-3-9(6-17)12-8-1-2-10-11(5-8)16-7-15-10/h1-2,5,9,12H,3-4,6-7H2 |
| InChIKey | JAKYRRGMLJXATB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|