C14H19NO4S — CID 63911451
N-(1,1-dioxothian-3-yl)-2,2-dimethyl-1,3-benzodioxol-5-amine (PubChem CID 63911451) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-2,2-dimethyl-1,3-benzodioxol-5-amine.
| Compound Name | N-(1,1-dioxothian-3-yl)-2,2-dimethyl-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 63911451 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-2,2-dimethyl-1,3-benzodioxol-5-amine |
| SMILES | CC1(C)Oc2ccc(NC3CCCS(=O)(=O)C3)cc2O1 |
| InChI | InChI=1S/C14H19NO4S/c1-14(2)18-12-6-5-10(8-13(12)19-14)15-11-4-3-7-20(16,17)9-11/h5-6,8,11,15H,3-4,7,9H2,1-2H3 |
| InChIKey | SOBJHXKDSGRVHP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|