C11H14FNO2S — CID 63910257
N-(4-fluorophenyl)-1,1-dioxothian-3-amine (PubChem CID 63910257) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1,1-dioxothian-3-amine.
| Compound Name | N-(4-fluorophenyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63910257 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-(4-fluorophenyl)-1,1-dioxothian-3-amine |
| SMILES | O=S1(=O)CCCC(Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C11H14FNO2S/c12-9-3-5-10(6-4-9)13-11-2-1-7-16(14,15)8-11/h3-6,11,13H,1-2,7-8H2 |
| InChIKey | QDYGUVXYCPEXNP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |