C12H15N5O2S — CID 63910839
1,1-dioxo-N-[4-(tetrazol-1-yl)phenyl]thian-3-amine (PubChem CID 63910839) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1,1-dioxo-N-[4-(tetrazol-1-yl)phenyl]thian-3-amine.
| Compound Name | 1,1-dioxo-N-[4-(tetrazol-1-yl)phenyl]thian-3-amine |
|---|---|
| PubChem CID | 63910839 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1,1-dioxo-N-[4-(tetrazol-1-yl)phenyl]thian-3-amine |
| SMILES | O=S1(=O)CCCC(Nc2ccc(-n3cnnn3)cc2)C1 |
| InChI | InChI=1S/C12H15N5O2S/c18-20(19)7-1-2-11(8-20)14-10-3-5-12(6-4-10)17-9-13-15-16-17/h3-6,9,11,14H,1-2,7-8H2 |
| InChIKey | MYYSXEUOTUPHJW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |