C12H14F3NO3S — CID 63909870
1,1-dioxo-N-[4-(trifluoromethoxy)phenyl]thian-3-amine (PubChem CID 63909870) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is 1,1-dioxo-N-[4-(trifluoromethoxy)phenyl]thian-3-amine.
| Compound Name | 1,1-dioxo-N-[4-(trifluoromethoxy)phenyl]thian-3-amine |
|---|---|
| PubChem CID | 63909870 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 1,1-dioxo-N-[4-(trifluoromethoxy)phenyl]thian-3-amine |
| SMILES | O=S1(=O)CCCC(Nc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C12H14F3NO3S/c13-12(14,15)19-11-5-3-9(4-6-11)16-10-2-1-7-20(17,18)8-10/h3-6,10,16H,1-2,7-8H2 |
| InChIKey | RYCKADBZJQNHPW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|